C22H29N3O6S — CID 58670431
(2S,3R)-2-[[(2S,3R)-2-[[4-(4-ethylphenyl)phenyl]sulfinylamino]-3-hydroxybutanoyl]amino]-N,3-dihydroxybutanamide (PubChem CID 58670431) has the molecular formula C22H29N3O6S and a molecular weight of 463.56 g/mol. Its IUPAC name is (2S,3R)-2-[[(2S,3R)-2-[[4-(4-ethylphenyl)phenyl]sulfinylamino]-3-hydroxybutanoyl]amino]-N,3-dihydroxybutanamide.
| Compound Name | (2S,3R)-2-[[(2S,3R)-2-[[4-(4-ethylphenyl)phenyl]sulfinylamino]-3-hydroxybutanoyl]amino]-N,3-dihydroxybutanamide |
|---|---|
| PubChem CID | 58670431 |
| Molecular Formula | C22H29N3O6S |
| Molecular Weight | 463.56 g/mol |
| Exact Mass | 463.18 |
| IUPAC Name | (2S,3R)-2-[[(2S,3R)-2-[[4-(4-ethylphenyl)phenyl]sulfinylamino]-3-hydroxybutanoyl]amino]-N,3-dihydroxybutanamide |
| SMILES | CCc1ccc(-c2ccc(S(=O)N[C@H](C(=O)N[C@H](C(=O)NO)[C@@H](C)O)[C@@H](C)O)cc2)cc1 |
| InChI | InChI=1S/C22H29N3O6S/c1-4-15-5-7-16(8-6-15)17-9-11-18(12-10-17)32(31)25-20(14(3)27)21(28)23-19(13(2)26)22(29)24-30/h5-14,19-20,25-27,30H,4H2,1-3H3,(H,23,28)(H,24,29)/t13-,14-,19+,20+,32?/m1/s1 |
| InChIKey | DVLNQFTWZXCYRU-LMKHOESVSA-N |
| XLogP | 0.65 |
| TPSA | 147.99 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.56 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|