C15H22N2O6 — CID 58670461
methyl (Z)-4-[[3-[[(Z)-4-methoxy-4-oxobut-2-enoyl]amino]-2,2-dimethylpropyl]amino]-4-oxobut-2-enoate (PubChem CID 58670461) has the molecular formula C15H22N2O6 and a molecular weight of 326.35 g/mol. Its IUPAC name is methyl (Z)-4-[[3-[[(Z)-4-methoxy-4-oxobut-2-enoyl]amino]-2,2-dimethylpropyl]amino]-4-oxobut-2-enoate.
| Compound Name | methyl (Z)-4-[[3-[[(Z)-4-methoxy-4-oxobut-2-enoyl]amino]-2,2-dimethylpropyl]amino]-4-oxobut-2-enoate |
|---|---|
| PubChem CID | 58670461 |
| Molecular Formula | C15H22N2O6 |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | methyl (Z)-4-[[3-[[(Z)-4-methoxy-4-oxobut-2-enoyl]amino]-2,2-dimethylpropyl]amino]-4-oxobut-2-enoate |
| SMILES | COC(=O)/C=C\C(=O)NCC(C)(C)CNC(=O)/C=C\C(=O)OC |
| InChI | InChI=1S/C15H22N2O6/c1-15(2,9-16-11(18)5-7-13(20)22-3)10-17-12(19)6-8-14(21)23-4/h5-8H,9-10H2,1-4H3,(H,16,18)(H,17,19)/b7-5-,8-6- |
| InChIKey | RAUNEVWJKRKEJU-SFECMWDFSA-N |
| XLogP | -0.30 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|