C13H26O3S8 — CID 58670734
S-(methylsulfanylmethyl) 2-[2-[2-(2-hydroxyethylsulfanyl)ethylsulfinyl]ethylsulfanylmethylsulfanylmethylsulfanylmethylsulfanyl]ethanethioate (PubChem CID 58670734) has the molecular formula C13H26O3S8 and a molecular weight of 486.88 g/mol. Its IUPAC name is S-(methylsulfanylmethyl) 2-[2-[2-(2-hydroxyethylsulfanyl)ethylsulfinyl]ethylsulfanylmethylsulfanylmethylsulfanylmethylsulfanyl]ethanethioate.
| Compound Name | S-(methylsulfanylmethyl) 2-[2-[2-(2-hydroxyethylsulfanyl)ethylsulfinyl]ethylsulfanylmethylsulfanylmethylsulfanylmethylsulfanyl]ethanethioate |
|---|---|
| PubChem CID | 58670734 |
| Molecular Formula | C13H26O3S8 |
| Molecular Weight | 486.88 g/mol |
| Exact Mass | 485.96 |
| IUPAC Name | S-(methylsulfanylmethyl) 2-[2-[2-(2-hydroxyethylsulfanyl)ethylsulfinyl]ethylsulfanylmethylsulfanylmethylsulfanylmethylsulfanyl]ethanethioate |
| SMILES | CSCSC(=O)CSCSCSCSCCS(=O)CCSCCO |
| InChI | InChI=1S/C13H26O3S8/c1-17-9-23-13(15)8-20-11-22-12-21-10-19-5-7-24(16)6-4-18-3-2-14/h14H,2-12H2,1H3 |
| InChIKey | YMSVHXVJPOVPEO-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.88 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|