C52H66N2O — CID 58671470
2-(2,7-dimethyl-9,9-dioctylfluoren-4-yl)-5-(9,9-dipropylfluoren-2-yl)-1,3,4-oxadiazole (PubChem CID 58671470) has the molecular formula C52H66N2O and a molecular weight of 735.11 g/mol. Its IUPAC name is 2-(2,7-dimethyl-9,9-dioctylfluoren-4-yl)-5-(9,9-dipropylfluoren-2-yl)-1,3,4-oxadiazole.
| Compound Name | 2-(2,7-dimethyl-9,9-dioctylfluoren-4-yl)-5-(9,9-dipropylfluoren-2-yl)-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 58671470 |
| Molecular Formula | C52H66N2O |
| Molecular Weight | 735.11 g/mol |
| Exact Mass | 734.52 |
| IUPAC Name | 2-(2,7-dimethyl-9,9-dioctylfluoren-4-yl)-5-(9,9-dipropylfluoren-2-yl)-1,3,4-oxadiazole |
| SMILES | CCCCCCCCC1(CCCCCCCC)c2cc(C)ccc2-c2c(-c3nnc(-c4ccc5c(c4)C(CCC)(CCC)c4ccccc4-5)o3)cc(C)cc21 |
| InChI | InChI=1S/C52H66N2O/c1-7-11-13-15-17-21-31-52(32-22-18-16-14-12-8-2)45-34-37(5)25-27-42(45)48-43(33-38(6)35-47(48)52)50-54-53-49(55-50)39-26-28-41-40-23-19-20-24-44(40)51(29-9-3,30-10-4)46(41)36-39/h19-20,23-28,33-36H,7-18,21-22,29-32H2,1-6H3 |
| InChIKey | JEESIWBGAWUXFZ-UHFFFAOYSA-N |
| XLogP | 15.65 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 735.11 |
| LogP ≤ 5 | 15.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|