C21H23N7O2 — CID 58671532
(3R,4R)-4-azido-1-[[4-(3-methoxyanilino)quinazolin-6-yl]methyl]piperidin-3-ol (PubChem CID 58671532) has the molecular formula C21H23N7O2 and a molecular weight of 405.46 g/mol. Its IUPAC name is (3R,4R)-4-azido-1-[[4-(3-methoxyanilino)quinazolin-6-yl]methyl]piperidin-3-ol.
| Compound Name | (3R,4R)-4-azido-1-[[4-(3-methoxyanilino)quinazolin-6-yl]methyl]piperidin-3-ol |
|---|---|
| PubChem CID | 58671532 |
| Molecular Formula | C21H23N7O2 |
| Molecular Weight | 405.46 g/mol |
| Exact Mass | 405.19 |
| IUPAC Name | (3R,4R)-4-azido-1-[[4-(3-methoxyanilino)quinazolin-6-yl]methyl]piperidin-3-ol |
| SMILES | COc1cccc(Nc2ncnc3ccc(CN4CC[C@@H](N=[N+]=[N-])[C@H](O)C4)cc23)c1 |
| InChI | InChI=1S/C21H23N7O2/c1-30-16-4-2-3-15(10-16)25-21-17-9-14(5-6-18(17)23-13-24-21)11-28-8-7-19(26-27-22)20(29)12-28/h2-6,9-10,13,19-20,29H,7-8,11-12H2,1H3,(H,23,24,25)/t19-,20-/m1/s1 |
| InChIKey | XSQWXDJFTYEZLF-WOJBJXKFSA-N |
| XLogP | 3.63 |
| TPSA | 119.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.46 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|