C21H25N5O2 — CID 58671535
(3R,4R)-4-amino-1-[[4-(3-methoxyanilino)quinazolin-6-yl]methyl]piperidin-3-ol (PubChem CID 58671535) has the molecular formula C21H25N5O2 and a molecular weight of 379.46 g/mol. Its IUPAC name is (3R,4R)-4-amino-1-[[4-(3-methoxyanilino)quinazolin-6-yl]methyl]piperidin-3-ol.
| Compound Name | (3R,4R)-4-amino-1-[[4-(3-methoxyanilino)quinazolin-6-yl]methyl]piperidin-3-ol |
|---|---|
| PubChem CID | 58671535 |
| Molecular Formula | C21H25N5O2 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.20 |
| IUPAC Name | (3R,4R)-4-amino-1-[[4-(3-methoxyanilino)quinazolin-6-yl]methyl]piperidin-3-ol |
| SMILES | COc1cccc(Nc2ncnc3ccc(CN4CC[C@@H](N)[C@H](O)C4)cc23)c1 |
| InChI | InChI=1S/C21H25N5O2/c1-28-16-4-2-3-15(10-16)25-21-17-9-14(5-6-19(17)23-13-24-21)11-26-8-7-18(22)20(27)12-26/h2-6,9-10,13,18,20,27H,7-8,11-12,22H2,1H3,(H,23,24,25)/t18-,20-/m1/s1 |
| InChIKey | RNYMAACHEAIPEY-UYAOXDASSA-N |
| XLogP | 2.28 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |