C11H19NO — CID 586717
1,2-dimethyl-2,3,4a,5,6,7,8,8a-octahydroquinolin-4-one (PubChem CID 586717) has the molecular formula C11H19NO and a molecular weight of 181.28 g/mol. Its IUPAC name is 1,2-dimethyl-2,3,4a,5,6,7,8,8a-octahydroquinolin-4-one.
| Compound Name | 1,2-dimethyl-2,3,4a,5,6,7,8,8a-octahydroquinolin-4-one |
|---|---|
| PubChem CID | 586717 |
| Molecular Formula | C11H19NO |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.15 |
| IUPAC Name | 1,2-dimethyl-2,3,4a,5,6,7,8,8a-octahydroquinolin-4-one |
| SMILES | CC1CC(=O)C2CCCCC2N1C |
| InChI | InChI=1S/C11H19NO/c1-8-7-11(13)9-5-3-4-6-10(9)12(8)2/h8-10H,3-7H2,1-2H3 |
| InChIKey | NYPDFJLDFGIPHL-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |