C16H19N5O2 — CID 58671721
N-[3-(dimethylamino)-6-[(E)-(1-hydroxy-3-methyl-2-pyridinylidene)hydrazinylidene]cyclohexa-2,4-dien-1-ylidene]acetamide (PubChem CID 58671721) has the molecular formula C16H19N5O2 and a molecular weight of 313.36 g/mol. Its IUPAC name is N-[3-(dimethylamino)-6-[(E)-(1-hydroxy-3-methyl-2-pyridinylidene)hydrazinylidene]cyclohexa-2,4-dien-1-ylidene]acetamide.
| Compound Name | N-[3-(dimethylamino)-6-[(E)-(1-hydroxy-3-methyl-2-pyridinylidene)hydrazinylidene]cyclohexa-2,4-dien-1-ylidene]acetamide |
|---|---|
| PubChem CID | 58671721 |
| Molecular Formula | C16H19N5O2 |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | N-[3-(dimethylamino)-6-[(E)-(1-hydroxy-3-methyl-2-pyridinylidene)hydrazinylidene]cyclohexa-2,4-dien-1-ylidene]acetamide |
| SMILES | CC(=O)/N=C1\C=C(N(C)C)C=CC1=N/N=c1\c(C)cccn1O |
| InChI | InChI=1S/C16H19N5O2/c1-11-6-5-9-21(23)16(11)19-18-14-8-7-13(20(3)4)10-15(14)17-12(2)22/h5-10,23H,1-4H3/b17-15+,18-14?,19-16+ |
| InChIKey | YGTWLNCCTLNEBW-HTTAPCSRSA-N |
| XLogP | 1.29 |
| TPSA | 82.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|