C36H34N8O2W2 — CID 58671740
1-N,4-N-dimethyl-1-N,4-N-bis[2-[2-(phenyldiazenyl)pyridin-1-ium-1-yl]ethyl]benzene-1,4-dicarboxamide;tungsten (PubChem CID 58671740) has the molecular formula C36H34N8O2W2 and a molecular weight of 978.40 g/mol. Its IUPAC name is 1-N,4-N-dimethyl-1-N,4-N-bis[2-[2-(phenyldiazenyl)pyridin-1-ium-1-yl]ethyl]benzene-1,4-dicarboxamide;tungsten.
| Compound Name | 1-N,4-N-dimethyl-1-N,4-N-bis[2-[2-(phenyldiazenyl)pyridin-1-ium-1-yl]ethyl]benzene-1,4-dicarboxamide;tungsten |
|---|---|
| PubChem CID | 58671740 |
| Molecular Formula | C36H34N8O2W2 |
| Molecular Weight | 978.40 g/mol |
| Exact Mass | 978.18 |
| IUPAC Name | 1-N,4-N-dimethyl-1-N,4-N-bis[2-[2-(phenyldiazenyl)pyridin-1-ium-1-yl]ethyl]benzene-1,4-dicarboxamide;tungsten |
| SMILES | CN(CC[n+]1ccccc1/N=N/c1cc[c-]cc1)C(=O)c1ccc(C(=O)N(C)CC[n+]2ccccc2/N=N/c2cc[c-]cc2)cc1.[W].[W] |
| InChI | InChI=1S/C36H34N8O2.2W/c1-41(25-27-43-23-11-9-17-33(43)39-37-31-13-5-3-6-14-31)35(45)29-19-21-30(22-20-29)36(46)42(2)26-28-44-24-12-10-18-34(44)40-38-32-15-7-4-8-16-32;;/h5-24H,25-28H2,1-2H3;; |
| InChIKey | WPZOKOYFLLYAGH-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 97.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 978.40 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|