About copper bis(2-[(1E)-1-(1,3-benzoxazol-3-id-2-ylidene)hexyl]-1,3-benzoxazole)
copper bis(2-[(1E)-1-(1,3-benzoxazol-3-id-2-ylidene)hexyl]-1,3-benzoxazole) (PubChem CID 58672154) has the molecular formula C40H38CuN4O4
and a molecular weight of 702.31 g/mol. Its IUPAC name is copper bis(2-[(1E)-1-(1,3-benzoxazol-3-id-2-ylidene)hexyl]-1,3-benzoxazole).
Molecular Properties
| Compound Name | copper bis(2-[(1E)-1-(1,3-benzoxazol-3-id-2-ylidene)hexyl]-1,3-benzoxazole) |
| PubChem CID | 58672154 |
| Molecular Formula | C40H38CuN4O4 |
| Molecular Weight | 702.31 g/mol |
| Exact Mass | 701.22 |
| IUPAC Name | copper bis(2-[(1E)-1-(1,3-benzoxazol-3-id-2-ylidene)hexyl]-1,3-benzoxazole) |
| SMILES | CCCCC/C(=C1/[N-]c2ccccc2O1)c1nc2ccccc2o1.CCCCC/C(=C1/[N-]c2ccccc2O1)c1nc2ccccc2o1.[Cu+2] |
| InChI | InChI=1S/2C20H19N2O2.Cu/c2*1-2-3-4-9-14(19-21-15-10-5-7-12-17(15)23-19)20-22-16-11-6-8-13-18(16)24-20;/h2*5-8,10-13H,2-4,9H2,1H3;/q2*-1;+2/b2*19-14+; |
| InChIKey | FYPHEACVYYUSIH-BFOTTZSISA-N |
| XLogP | 12.35 |
| TPSA | 98.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 702.31 |
| LogP ≤ 5 | 12.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze copper bis(2-[(1E)-1-(1,3-benzoxazol-3-id-2-ylidene)hexyl]-1,3-benzoxazole) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of copper bis(2-[(1E)-1-(1,3-benzoxazol-3-id-2-ylidene)hexyl]-1,3-benzoxazole)?
The IUPAC name of copper bis(2-[(1E)-1-(1,3-benzoxazol-3-id-2-ylidene)hexyl]-1,3-benzoxazole) (CID 58672154) is copper bis(2-[(1E)-1-(1,3-benzoxazol-3-id-2-ylidene)hexyl]-1,3-benzoxazole).
What is the SMILES notation for copper bis(2-[(1E)-1-(1,3-benzoxazol-3-id-2-ylidene)hexyl]-1,3-benzoxazole)?
The canonical SMILES for copper bis(2-[(1E)-1-(1,3-benzoxazol-3-id-2-ylidene)hexyl]-1,3-benzoxazole) is CCCCC/C(=C1/[N-]c2ccccc2O1)c1nc2ccccc2o1.CCCCC/C(=C1/[N-]c2ccccc2O1)c1nc2ccccc2o1.[Cu+2].
What is the InChIKey of copper bis(2-[(1E)-1-(1,3-benzoxazol-3-id-2-ylidene)hexyl]-1,3-benzoxazole)?
The InChIKey is FYPHEACVYYUSIH-BFOTTZSISA-N. The full InChI is InChI=1S/2C20H19N2O2.Cu/c2*1-2-3-4-9-14(19-21-15-10-5-7-12-17(15)23-19)20-22-16-11-6-8-13-18(16)24-20;/h2*5-8,10-13H,2-4,9H2,1H3;/q2*-1;+2/b2*19-14+;.
What are the key properties of copper bis(2-[(1E)-1-(1,3-benzoxazol-3-id-2-ylidene)hexyl]-1,3-benzoxazole)?
copper bis(2-[(1E)-1-(1,3-benzoxazol-3-id-2-ylidene)hexyl]-1,3-benzoxazole) has a molecular weight of 702.31 g/mol, XLogP of 12.35, 10 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for copper bis(2-[(1E)-1-(1,3-benzoxazol-3-id-2-ylidene)hexyl]-1,3-benzoxazole) is sourced from PubChem (CID 58672154), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).