C12H22F3NO3 — CID 58672688
N-(9,10-dihydroxydecyl)-2,2,2-trifluoroacetamide (PubChem CID 58672688) has the molecular formula C12H22F3NO3 and a molecular weight of 285.31 g/mol. Its IUPAC name is N-(9,10-dihydroxydecyl)-2,2,2-trifluoroacetamide.
| Compound Name | N-(9,10-dihydroxydecyl)-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 58672688 |
| Molecular Formula | C12H22F3NO3 |
| Molecular Weight | 285.31 g/mol |
| Exact Mass | 285.16 |
| IUPAC Name | N-(9,10-dihydroxydecyl)-2,2,2-trifluoroacetamide |
| SMILES | O=C(NCCCCCCCCC(O)CO)C(F)(F)F |
| InChI | InChI=1S/C12H22F3NO3/c13-12(14,15)11(19)16-8-6-4-2-1-3-5-7-10(18)9-17/h10,17-18H,1-9H2,(H,16,19) |
| InChIKey | SIMILTSQQZADRH-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.31 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|