C28H60O4Si3 — CID 58672951
2-[(3R,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-4-[2-[tert-butyl(dimethyl)silyl]oxyethyl]cyclohexylidene]ethanol (PubChem CID 58672951) has the molecular formula C28H60O4Si3 and a molecular weight of 545.04 g/mol. Its IUPAC name is 2-[(3R,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-4-[2-[tert-butyl(dimethyl)silyl]oxyethyl]cyclohexylidene]ethanol.
| Compound Name | 2-[(3R,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-4-[2-[tert-butyl(dimethyl)silyl]oxyethyl]cyclohexylidene]ethanol |
|---|---|
| PubChem CID | 58672951 |
| Molecular Formula | C28H60O4Si3 |
| Molecular Weight | 545.04 g/mol |
| Exact Mass | 544.38 |
| IUPAC Name | 2-[(3R,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-4-[2-[tert-butyl(dimethyl)silyl]oxyethyl]cyclohexylidene]ethanol |
| SMILES | CC(C)(C)[Si](C)(C)OCCC1[C@H](O[Si](C)(C)C(C)(C)C)CC(=CCO)C[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C28H60O4Si3/c1-26(2,3)33(10,11)30-19-17-23-24(31-34(12,13)27(4,5)6)20-22(16-18-29)21-25(23)32-35(14,15)28(7,8)9/h16,23-25,29H,17-21H2,1-15H3/b22-16-/t23?,24-,25-/m1/s1 |
| InChIKey | BLFKEUIOGLTAQO-WIGPAWAVSA-N |
| XLogP | 8.51 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.04 |
| LogP ≤ 5 | 8.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|