C24H52O4Si3 — CID 58672956
2-[(3R,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-4-methyl-4-trimethylsilyloxycyclohexylidene]ethanol (PubChem CID 58672956) has the molecular formula C24H52O4Si3 and a molecular weight of 488.93 g/mol. Its IUPAC name is 2-[(3R,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-4-methyl-4-trimethylsilyloxycyclohexylidene]ethanol.
| Compound Name | 2-[(3R,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-4-methyl-4-trimethylsilyloxycyclohexylidene]ethanol |
|---|---|
| PubChem CID | 58672956 |
| Molecular Formula | C24H52O4Si3 |
| Molecular Weight | 488.93 g/mol |
| Exact Mass | 488.32 |
| IUPAC Name | 2-[(3R,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-4-methyl-4-trimethylsilyloxycyclohexylidene]ethanol |
| SMILES | CC1(O[Si](C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)CC(=CCO)C[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C24H52O4Si3/c1-22(2,3)30(11,12)26-20-17-19(15-16-25)18-21(24(20,7)28-29(8,9)10)27-31(13,14)23(4,5)6/h15,20-21,25H,16-18H2,1-14H3/b19-15-/t20-,21-,24?/m1/s1 |
| InChIKey | XRDPZDJEVAJNBC-UJPZHLMMSA-N |
| XLogP | 7.09 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.93 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|