C27H50O2Si — CID 58672995
(4E,6E,8R)-8-[(4S)-4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-3-ethylnona-4,6-dien-3-ol (PubChem CID 58672995) has the molecular formula C27H50O2Si and a molecular weight of 434.78 g/mol. Its IUPAC name is (4E,6E,8R)-8-[(4S)-4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-3-ethylnona-4,6-dien-3-ol.
| Compound Name | (4E,6E,8R)-8-[(4S)-4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-3-ethylnona-4,6-dien-3-ol |
|---|---|
| PubChem CID | 58672995 |
| Molecular Formula | C27H50O2Si |
| Molecular Weight | 434.78 g/mol |
| Exact Mass | 434.36 |
| IUPAC Name | (4E,6E,8R)-8-[(4S)-4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-3-ethylnona-4,6-dien-3-ol |
| SMILES | CCC(O)(/C=C/C=C/[C@@H](C)C1CCC2[C@@H](O[Si](C)(C)C(C)(C)C)CCCC12C)CC |
| InChI | InChI=1S/C27H50O2Si/c1-10-27(28,11-2)20-13-12-15-21(3)22-17-18-23-24(16-14-19-26(22,23)7)29-30(8,9)25(4,5)6/h12-13,15,20-24,28H,10-11,14,16-19H2,1-9H3/b15-12+,20-13+/t21-,22?,23?,24+,26?/m1/s1 |
| InChIKey | QBSNHAVDBDDKFP-URXHFVAQSA-N |
| XLogP | 7.89 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.78 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|