C32H56O5SSi — CID 58673001
[(4S)-1-[(2S)-4-(benzenesulfonyl)-6-(methoxymethoxy)-6-methylheptan-2-yl]-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-4-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 58673001) has the molecular formula C32H56O5SSi and a molecular weight of 580.95 g/mol. Its IUPAC name is [(4S)-1-[(2S)-4-(benzenesulfonyl)-6-(methoxymethoxy)-6-methylheptan-2-yl]-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-4-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(4S)-1-[(2S)-4-(benzenesulfonyl)-6-(methoxymethoxy)-6-methylheptan-2-yl]-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-4-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 58673001 |
| Molecular Formula | C32H56O5SSi |
| Molecular Weight | 580.95 g/mol |
| Exact Mass | 580.36 |
| IUPAC Name | [(4S)-1-[(2S)-4-(benzenesulfonyl)-6-(methoxymethoxy)-6-methylheptan-2-yl]-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-4-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | COCOC(C)(C)CC(C[C@H](C)C1CCC2[C@@H](O[Si](C)(C)C(C)(C)C)CCCC21C)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C32H56O5SSi/c1-24(21-26(22-31(5,6)36-23-35-8)38(33,34)25-15-12-11-13-16-25)27-18-19-28-29(17-14-20-32(27,28)7)37-39(9,10)30(2,3)4/h11-13,15-16,24,26-29H,14,17-23H2,1-10H3/t24-,26?,27?,28?,29-,32?/m0/s1 |
| InChIKey | OCMITMOAIIFPLW-WRPUDCOGSA-N |
| XLogP | 8.25 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.95 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|