C21H44O4Si2 — CID 58673046
trans-(2R,6R)-2,6-bis[[tert-butyl(dimethyl)silyl]oxy]-4-(2-hydroxyethylidene)-1-methylcyclohexan-1-ol (PubChem CID 58673046) has the molecular formula C21H44O4Si2 and a molecular weight of 416.75 g/mol. Its IUPAC name is trans-(2R,6R)-2,6-bis[[tert-butyl(dimethyl)silyl]oxy]-4-(2-hydroxyethylidene)-1-methylcyclohexan-1-ol.
| Compound Name | trans-(2R,6R)-2,6-bis[[tert-butyl(dimethyl)silyl]oxy]-4-(2-hydroxyethylidene)-1-methylcyclohexan-1-ol |
|---|---|
| PubChem CID | 58673046 |
| Molecular Formula | C21H44O4Si2 |
| Molecular Weight | 416.75 g/mol |
| Exact Mass | 416.28 |
| IUPAC Name | trans-(2R,6R)-2,6-bis[[tert-butyl(dimethyl)silyl]oxy]-4-(2-hydroxyethylidene)-1-methylcyclohexan-1-ol |
| SMILES | CC1(O)[C@H](O[Si](C)(C)C(C)(C)C)CC(=CCO)C[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H44O4Si2/c1-19(2,3)26(8,9)24-17-14-16(12-13-22)15-18(21(17,7)23)25-27(10,11)20(4,5)6/h12,17-18,22-23H,13-15H2,1-11H3/b16-12-/t17-,18-,21?/m1/s1 |
| InChIKey | WHOLAZOSTVMNBW-RVVDQMKJSA-N |
| XLogP | 5.23 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.75 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|