C24H23ClF6N4O2 — CID 58673136
1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-butoxy-N-[(2-chlorophenyl)methyl]-N-methyltriazole-4-carboxamide (PubChem CID 58673136) has the molecular formula C24H23ClF6N4O2 and a molecular weight of 548.92 g/mol. Its IUPAC name is 1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-butoxy-N-[(2-chlorophenyl)methyl]-N-methyltriazole-4-carboxamide.
| Compound Name | 1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-butoxy-N-[(2-chlorophenyl)methyl]-N-methyltriazole-4-carboxamide |
|---|---|
| PubChem CID | 58673136 |
| Molecular Formula | C24H23ClF6N4O2 |
| Molecular Weight | 548.92 g/mol |
| Exact Mass | 548.14 |
| IUPAC Name | 1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-butoxy-N-[(2-chlorophenyl)methyl]-N-methyltriazole-4-carboxamide |
| SMILES | CCCCOc1c(C(=O)N(C)Cc2ccccc2Cl)nnn1Cc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C24H23ClF6N4O2/c1-3-4-9-37-22-20(21(36)34(2)14-16-7-5-6-8-19(16)25)32-33-35(22)13-15-10-17(23(26,27)28)12-18(11-15)24(29,30)31/h5-8,10-12H,3-4,9,13-14H2,1-2H3 |
| InChIKey | OAGKMMFRZUTOLY-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.92 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|