C37H42 — CID 58673869
(2Z)-4-cyclopenta-1,3-dien-1-yl-6-methyl-3-methylidene-2-[[4-(4-methyl-3-prop-1-en-2-ylphenyl)cyclopenta-1,3-dien-1-yl]methylidene]-5-pent-1-en-2-yl-3a,4,5,6-tetrahydro-1H-indene (PubChem CID 58673869) has the molecular formula C37H42 and a molecular weight of 486.74 g/mol. Its IUPAC name is (2Z)-4-cyclopenta-1,3-dien-1-yl-6-methyl-3-methylidene-2-[[4-(4-methyl-3-prop-1-en-2-ylphenyl)cyclopenta-1,3-dien-1-yl]methylidene]-5-pent-1-en-2-yl-3a,4,5,6-tetrahydro-1H-indene.
| Compound Name | (2Z)-4-cyclopenta-1,3-dien-1-yl-6-methyl-3-methylidene-2-[[4-(4-methyl-3-prop-1-en-2-ylphenyl)cyclopenta-1,3-dien-1-yl]methylidene]-5-pent-1-en-2-yl-3a,4,5,6-tetrahydro-1H-indene |
|---|---|
| PubChem CID | 58673869 |
| Molecular Formula | C37H42 |
| Molecular Weight | 486.74 g/mol |
| Exact Mass | 486.33 |
| IUPAC Name | (2Z)-4-cyclopenta-1,3-dien-1-yl-6-methyl-3-methylidene-2-[[4-(4-methyl-3-prop-1-en-2-ylphenyl)cyclopenta-1,3-dien-1-yl]methylidene]-5-pent-1-en-2-yl-3a,4,5,6-tetrahydro-1H-indene |
| SMILES | C=C(C)c1cc(C2=CC=C(/C=C3/CC4=CC(C)C(C(=C)CCC)C(C5=CC=CC5)C4C3=C)C2)ccc1C |
| InChI | InChI=1S/C37H42/c1-8-11-25(5)35-26(6)18-33-21-32(27(7)36(33)37(35)29-12-9-10-13-29)20-28-15-17-30(19-28)31-16-14-24(4)34(22-31)23(2)3/h9-10,12,14-18,20,22,26,35-37H,2,5,7-8,11,13,19,21H2,1,3-4,6H3/b32-20- |
| InChIKey | MSQORCDTDXSCAM-RGXNXFOYSA-N |
| XLogP | 10.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.74 |
| LogP ≤ 5 | 10.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|