C20H24O2 — CID 58674968
(3R,6R)-10-pentyl-9-phenyl-7-oxatricyclo[4.3.1.03,10]dec-1(9)-en-8-one (PubChem CID 58674968) has the molecular formula C20H24O2 and a molecular weight of 296.41 g/mol. Its IUPAC name is (3R,6R)-10-pentyl-9-phenyl-7-oxatricyclo[4.3.1.03,10]dec-1(9)-en-8-one.
| Compound Name | (3R,6R)-10-pentyl-9-phenyl-7-oxatricyclo[4.3.1.03,10]dec-1(9)-en-8-one |
|---|---|
| PubChem CID | 58674968 |
| Molecular Formula | C20H24O2 |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.18 |
| IUPAC Name | (3R,6R)-10-pentyl-9-phenyl-7-oxatricyclo[4.3.1.03,10]dec-1(9)-en-8-one |
| SMILES | CCCCCC12C3=C(c4ccccc4)C(=O)O[C@@H]1CC[C@@H]2C3 |
| InChI | InChI=1S/C20H24O2/c1-2-3-7-12-20-15-10-11-17(20)22-19(21)18(16(20)13-15)14-8-5-4-6-9-14/h4-6,8-9,15,17H,2-3,7,10-13H2,1H3/t15-,17-,20?/m1/s1 |
| InChIKey | SUBTYMHCNUSWJV-LSOHHRALSA-N |
| XLogP | 4.75 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|