C16H29N — CID 586751
5-hept-6-enyl-8-methyl-1,2,3,5,6,7,8,8a-octahydroindolizine (PubChem CID 586751) has the molecular formula C16H29N and a molecular weight of 235.41 g/mol. Its IUPAC name is 5-hept-6-enyl-8-methyl-1,2,3,5,6,7,8,8a-octahydroindolizine.
| Compound Name | 5-hept-6-enyl-8-methyl-1,2,3,5,6,7,8,8a-octahydroindolizine |
|---|---|
| PubChem CID | 586751 |
| Molecular Formula | C16H29N |
| Molecular Weight | 235.41 g/mol |
| Exact Mass | 235.23 |
| IUPAC Name | 5-hept-6-enyl-8-methyl-1,2,3,5,6,7,8,8a-octahydroindolizine |
| SMILES | C=CCCCCCC1CCC(C)C2CCCN12 |
| InChI | InChI=1S/C16H29N/c1-3-4-5-6-7-9-15-12-11-14(2)16-10-8-13-17(15)16/h3,14-16H,1,4-13H2,2H3 |
| InChIKey | AQVPQPSGQZHEBC-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.41 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|