About 4-(dimethylamino)pyridine-2-sulfonic acid;iridium;2-phenylpyridine
4-(dimethylamino)pyridine-2-sulfonic acid;iridium;2-phenylpyridine (PubChem CID 58675845) has the molecular formula C18H18IrN3O3S-
and a molecular weight of 548.64 g/mol. Its IUPAC name is 4-(dimethylamino)pyridine-2-sulfonic acid;iridium;2-phenylpyridine.
Molecular Properties
| Compound Name | 4-(dimethylamino)pyridine-2-sulfonic acid;iridium;2-phenylpyridine |
| PubChem CID | 58675845 |
| Molecular Formula | C18H18IrN3O3S- |
| Molecular Weight | 548.64 g/mol |
| Exact Mass | 549.07 |
| IUPAC Name | 4-(dimethylamino)pyridine-2-sulfonic acid;iridium;2-phenylpyridine |
| SMILES | CN(C)c1ccnc(S(=O)(=O)O)c1.[Ir].[c-]1ccccc1-c1ccccn1 |
| InChI | InChI=1S/C11H8N.C7H10N2O3S.Ir/c1-2-6-10(7-3-1)11-8-4-5-9-12-11;1-9(2)6-3-4-8-7(5-6)13(10,11)12;/h1-6,8-9H;3-5H,1-2H3,(H,10,11,12);/q-1;; |
| InChIKey | BAVCTZOLGFGZAK-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 83.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 548.64 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 4-(dimethylamino)pyridine-2-sulfonic acid;iridium;2-phenylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(dimethylamino)pyridine-2-sulfonic acid;iridium;2-phenylpyridine?
The IUPAC name of 4-(dimethylamino)pyridine-2-sulfonic acid;iridium;2-phenylpyridine (CID 58675845) is 4-(dimethylamino)pyridine-2-sulfonic acid;iridium;2-phenylpyridine.
What is the SMILES notation for 4-(dimethylamino)pyridine-2-sulfonic acid;iridium;2-phenylpyridine?
The canonical SMILES for 4-(dimethylamino)pyridine-2-sulfonic acid;iridium;2-phenylpyridine is CN(C)c1ccnc(S(=O)(=O)O)c1.[Ir].[c-]1ccccc1-c1ccccn1.
What is the InChIKey of 4-(dimethylamino)pyridine-2-sulfonic acid;iridium;2-phenylpyridine?
The InChIKey is BAVCTZOLGFGZAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8N.C7H10N2O3S.Ir/c1-2-6-10(7-3-1)11-8-4-5-9-12-11;1-9(2)6-3-4-8-7(5-6)13(10,11)12;/h1-6,8-9H;3-5H,1-2H3,(H,10,11,12);/q-1;;.
What are the key properties of 4-(dimethylamino)pyridine-2-sulfonic acid;iridium;2-phenylpyridine?
4-(dimethylamino)pyridine-2-sulfonic acid;iridium;2-phenylpyridine has a molecular weight of 548.64 g/mol, XLogP of 2.94, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(dimethylamino)pyridine-2-sulfonic acid;iridium;2-phenylpyridine is sourced from PubChem (CID 58675845), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).