About 2-(2,4-difluorobenzene-6-id-1-yl)-4-methoxypyridine;iridium;pyridine-2-sulfonic acid
2-(2,4-difluorobenzene-6-id-1-yl)-4-methoxypyridine;iridium;pyridine-2-sulfonic acid (PubChem CID 58675883) has the molecular formula C17H13F2IrN2O4S-
and a molecular weight of 571.58 g/mol. Its IUPAC name is 2-(2,4-difluorobenzene-6-id-1-yl)-4-methoxypyridine;iridium;pyridine-2-sulfonic acid.
Molecular Properties
| Compound Name | 2-(2,4-difluorobenzene-6-id-1-yl)-4-methoxypyridine;iridium;pyridine-2-sulfonic acid |
| PubChem CID | 58675883 |
| Molecular Formula | C17H13F2IrN2O4S- |
| Molecular Weight | 571.58 g/mol |
| Exact Mass | 572.02 |
| IUPAC Name | 2-(2,4-difluorobenzene-6-id-1-yl)-4-methoxypyridine;iridium;pyridine-2-sulfonic acid |
| SMILES | COc1ccnc(-c2[c-]cc(F)cc2F)c1.O=S(=O)(O)c1ccccn1.[Ir] |
| InChI | InChI=1S/C12H8F2NO.C5H5NO3S.Ir/c1-16-9-4-5-15-12(7-9)10-3-2-8(13)6-11(10)14;7-10(8,9)5-3-1-2-4-6-5;/h2,4-7H,1H3;1-4H,(H,7,8,9);/q-1;; |
| InChIKey | LMGXZDLAPPOAMP-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 89.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 571.58 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,4-difluorobenzene-6-id-1-yl)-4-methoxypyridine;iridium;pyridine-2-sulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,4-difluorobenzene-6-id-1-yl)-4-methoxypyridine;iridium;pyridine-2-sulfonic acid?
The IUPAC name of 2-(2,4-difluorobenzene-6-id-1-yl)-4-methoxypyridine;iridium;pyridine-2-sulfonic acid (CID 58675883) is 2-(2,4-difluorobenzene-6-id-1-yl)-4-methoxypyridine;iridium;pyridine-2-sulfonic acid.
What is the SMILES notation for 2-(2,4-difluorobenzene-6-id-1-yl)-4-methoxypyridine;iridium;pyridine-2-sulfonic acid?
The canonical SMILES for 2-(2,4-difluorobenzene-6-id-1-yl)-4-methoxypyridine;iridium;pyridine-2-sulfonic acid is COc1ccnc(-c2[c-]cc(F)cc2F)c1.O=S(=O)(O)c1ccccn1.[Ir].
What is the InChIKey of 2-(2,4-difluorobenzene-6-id-1-yl)-4-methoxypyridine;iridium;pyridine-2-sulfonic acid?
The InChIKey is LMGXZDLAPPOAMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8F2NO.C5H5NO3S.Ir/c1-16-9-4-5-15-12(7-9)10-3-2-8(13)6-11(10)14;7-10(8,9)5-3-1-2-4-6-5;/h2,4-7H,1H3;1-4H,(H,7,8,9);/q-1;;.
What are the key properties of 2-(2,4-difluorobenzene-6-id-1-yl)-4-methoxypyridine;iridium;pyridine-2-sulfonic acid?
2-(2,4-difluorobenzene-6-id-1-yl)-4-methoxypyridine;iridium;pyridine-2-sulfonic acid has a molecular weight of 571.58 g/mol, XLogP of 3.16, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,4-difluorobenzene-6-id-1-yl)-4-methoxypyridine;iridium;pyridine-2-sulfonic acid is sourced from PubChem (CID 58675883), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).