C13H12F13NO — CID 58676063
N-(2-ethyl-3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)prop-2-enamide (PubChem CID 58676063) has the molecular formula C13H12F13NO and a molecular weight of 445.22 g/mol. Its IUPAC name is N-(2-ethyl-3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)prop-2-enamide.
| Compound Name | N-(2-ethyl-3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)prop-2-enamide |
|---|---|
| PubChem CID | 58676063 |
| Molecular Formula | C13H12F13NO |
| Molecular Weight | 445.22 g/mol |
| Exact Mass | 445.07 |
| IUPAC Name | N-(2-ethyl-3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)prop-2-enamide |
| SMILES | C=CC(=O)NCC(CC)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C13H12F13NO/c1-3-6(5-27-7(28)4-2)8(14,15)9(16,17)10(18,19)11(20,21)12(22,23)13(24,25)26/h4,6H,2-3,5H2,1H3,(H,27,28) |
| InChIKey | YOAHXXZEIFCZFK-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.22 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|