C29H43F13O10 — CID 58676073
1-O-[2-[2-[2-[2-[3-(3-hydroxypropoxy)propoxy]ethoxy]ethoxy]ethoxy]ethyl] 5-O-(2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptyl) 4-ethyl-2-methylpentanedioate (PubChem CID 58676073) has the molecular formula C29H43F13O10 and a molecular weight of 798.63 g/mol. Its IUPAC name is 1-O-[2-[2-[2-[2-[3-(3-hydroxypropoxy)propoxy]ethoxy]ethoxy]ethoxy]ethyl] 5-O-(2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptyl) 4-ethyl-2-methylpentanedioate.
| Compound Name | 1-O-[2-[2-[2-[2-[3-(3-hydroxypropoxy)propoxy]ethoxy]ethoxy]ethoxy]ethyl] 5-O-(2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptyl) 4-ethyl-2-methylpentanedioate |
|---|---|
| PubChem CID | 58676073 |
| Molecular Formula | C29H43F13O10 |
| Molecular Weight | 798.63 g/mol |
| Exact Mass | 798.26 |
| IUPAC Name | 1-O-[2-[2-[2-[2-[3-(3-hydroxypropoxy)propoxy]ethoxy]ethoxy]ethoxy]ethyl] 5-O-(2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptyl) 4-ethyl-2-methylpentanedioate |
| SMILES | CCC(CC(C)C(=O)OCCOCCOCCOCCOCCCOCCCO)C(=O)OCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C29H43F13O10/c1-3-21(23(45)52-19-24(30,31)25(32,33)26(34,35)27(36,37)28(38,39)29(40,41)42)18-20(2)22(44)51-17-16-50-15-14-49-13-12-48-11-10-47-9-5-8-46-7-4-6-43/h20-21,43H,3-19H2,1-2H3 |
| InChIKey | YWFMDVJWCXBIGR-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 118.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 798.63 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|