About [3-oxo-2-(trifluoromethyl)-4-oxatricyclo[5.2.1.02,6]decan-8-yl] 2,2-dimethylbutanoate
[3-oxo-2-(trifluoromethyl)-4-oxatricyclo[5.2.1.02,6]decan-8-yl] 2,2-dimethylbutanoate (PubChem CID 58676265) has the molecular formula C16H21F3O4
and a molecular weight of 334.33 g/mol. Its IUPAC name is [3-oxo-2-(trifluoromethyl)-4-oxatricyclo[5.2.1.02,6]decan-8-yl] 2,2-dimethylbutanoate.
Molecular Properties
| Compound Name | [3-oxo-2-(trifluoromethyl)-4-oxatricyclo[5.2.1.02,6]decan-8-yl] 2,2-dimethylbutanoate |
| PubChem CID | 58676265 |
| Molecular Formula | C16H21F3O4 |
| Molecular Weight | 334.33 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | [3-oxo-2-(trifluoromethyl)-4-oxatricyclo[5.2.1.02,6]decan-8-yl] 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OC1CC2CC1C1COC(=O)C21C(F)(F)F |
| InChI | InChI=1S/C16H21F3O4/c1-4-14(2,3)12(20)23-11-6-8-5-9(11)10-7-22-13(21)15(8,10)16(17,18)19/h8-11H,4-7H2,1-3H3 |
| InChIKey | BSAJNLRVXHWAOM-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.33 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [3-oxo-2-(trifluoromethyl)-4-oxatricyclo[5.2.1.02,6]decan-8-yl] 2,2-dimethylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-oxo-2-(trifluoromethyl)-4-oxatricyclo[5.2.1.02,6]decan-8-yl] 2,2-dimethylbutanoate?
The IUPAC name of [3-oxo-2-(trifluoromethyl)-4-oxatricyclo[5.2.1.02,6]decan-8-yl] 2,2-dimethylbutanoate (CID 58676265) is [3-oxo-2-(trifluoromethyl)-4-oxatricyclo[5.2.1.02,6]decan-8-yl] 2,2-dimethylbutanoate.
What is the SMILES notation for [3-oxo-2-(trifluoromethyl)-4-oxatricyclo[5.2.1.02,6]decan-8-yl] 2,2-dimethylbutanoate?
The canonical SMILES for [3-oxo-2-(trifluoromethyl)-4-oxatricyclo[5.2.1.02,6]decan-8-yl] 2,2-dimethylbutanoate is CCC(C)(C)C(=O)OC1CC2CC1C1COC(=O)C21C(F)(F)F.
What is the InChIKey of [3-oxo-2-(trifluoromethyl)-4-oxatricyclo[5.2.1.02,6]decan-8-yl] 2,2-dimethylbutanoate?
The InChIKey is BSAJNLRVXHWAOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21F3O4/c1-4-14(2,3)12(20)23-11-6-8-5-9(11)10-7-22-13(21)15(8,10)16(17,18)19/h8-11H,4-7H2,1-3H3.
What are the key properties of [3-oxo-2-(trifluoromethyl)-4-oxatricyclo[5.2.1.02,6]decan-8-yl] 2,2-dimethylbutanoate?
[3-oxo-2-(trifluoromethyl)-4-oxatricyclo[5.2.1.02,6]decan-8-yl] 2,2-dimethylbutanoate has a molecular weight of 334.33 g/mol, XLogP of 3.10, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3-oxo-2-(trifluoromethyl)-4-oxatricyclo[5.2.1.02,6]decan-8-yl] 2,2-dimethylbutanoate is sourced from PubChem (CID 58676265), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).