C29H34N4O8 — CID 58676893
(4S,4aS,5aR,12aS)-4-(dimethylamino)-1,10,12,12a-tetrahydroxy-7-[2-[(1-methylpyrrol-2-yl)methylamino]acetyl]-3,11-dioxo-4a,5,5a,6,11a,12-hexahydro-4H-tetracene-2-carboxamide (PubChem CID 58676893) has the molecular formula C29H34N4O8 and a molecular weight of 566.61 g/mol. Its IUPAC name is (4S,4aS,5aR,12aS)-4-(dimethylamino)-1,10,12,12a-tetrahydroxy-7-[2-[(1-methylpyrrol-2-yl)methylamino]acetyl]-3,11-dioxo-4a,5,5a,6,11a,12-hexahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4S,4aS,5aR,12aS)-4-(dimethylamino)-1,10,12,12a-tetrahydroxy-7-[2-[(1-methylpyrrol-2-yl)methylamino]acetyl]-3,11-dioxo-4a,5,5a,6,11a,12-hexahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 58676893 |
| Molecular Formula | C29H34N4O8 |
| Molecular Weight | 566.61 g/mol |
| Exact Mass | 566.24 |
| IUPAC Name | (4S,4aS,5aR,12aS)-4-(dimethylamino)-1,10,12,12a-tetrahydroxy-7-[2-[(1-methylpyrrol-2-yl)methylamino]acetyl]-3,11-dioxo-4a,5,5a,6,11a,12-hexahydro-4H-tetracene-2-carboxamide |
| SMILES | CN(C)[C@@H]1C(=O)C(C(N)=O)=C(O)[C@@]2(O)C(O)C3C(=O)c4c(O)ccc(C(=O)CNCc5cccn5C)c4C[C@H]3C[C@@H]12 |
| InChI | InChI=1S/C29H34N4O8/c1-32(2)23-17-10-13-9-16-15(19(35)12-31-11-14-5-4-8-33(14)3)6-7-18(34)21(16)24(36)20(13)26(38)29(17,41)27(39)22(25(23)37)28(30)40/h4-8,13,17,20,23,26,31,34,38-39,41H,9-12H2,1-3H3,(H2,30,40)/t13-,17-,20?,23-,26?,29-/m0/s1 |
| InChIKey | JHLIDERURRCANJ-HXEZVWLVSA-N |
| XLogP | -0.40 |
| TPSA | 195.42 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.61 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|