C19H38OSi — CID 58676937
[(3aR,4S,7aR)-7a-methyl-1-propan-2-yl-1,2,3,3a,4,5,6,7-octahydroinden-4-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 58676937) has the molecular formula C19H38OSi and a molecular weight of 310.60 g/mol. Its IUPAC name is [(3aR,4S,7aR)-7a-methyl-1-propan-2-yl-1,2,3,3a,4,5,6,7-octahydroinden-4-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(3aR,4S,7aR)-7a-methyl-1-propan-2-yl-1,2,3,3a,4,5,6,7-octahydroinden-4-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 58676937 |
| Molecular Formula | C19H38OSi |
| Molecular Weight | 310.60 g/mol |
| Exact Mass | 310.27 |
| IUPAC Name | [(3aR,4S,7aR)-7a-methyl-1-propan-2-yl-1,2,3,3a,4,5,6,7-octahydroinden-4-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | CC(C)C1CC[C@H]2[C@@H](O[Si](C)(C)C(C)(C)C)CCC[C@]12C |
| InChI | InChI=1S/C19H38OSi/c1-14(2)15-11-12-16-17(10-9-13-19(15,16)6)20-21(7,8)18(3,4)5/h14-17H,9-13H2,1-8H3/t15?,16-,17-,19+/m0/s1 |
| InChIKey | VJHMMRGHNHKGIF-OSCZMGMTSA-N |
| XLogP | 6.25 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.60 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|