C15H20O10 — CID 586779
1,3,4,5-tetraacetyloxycyclohexane-1-carboxylic acid (PubChem CID 586779) has the molecular formula C15H20O10 and a molecular weight of 360.32 g/mol. Its IUPAC name is 1,3,4,5-tetraacetyloxycyclohexane-1-carboxylic acid.
| Compound Name | 1,3,4,5-tetraacetyloxycyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 586779 |
| Molecular Formula | C15H20O10 |
| Molecular Weight | 360.32 g/mol |
| Exact Mass | 360.11 |
| IUPAC Name | 1,3,4,5-tetraacetyloxycyclohexane-1-carboxylic acid |
| SMILES | CC(=O)OC1CC(OC(C)=O)(C(=O)O)CC(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C15H20O10/c1-7(16)22-11-5-15(14(20)21,25-10(4)19)6-12(23-8(2)17)13(11)24-9(3)18/h11-13H,5-6H2,1-4H3,(H,20,21) |
| InChIKey | AQDXBJGFGAIZBE-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 142.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.32 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|