C24H21ClFN3O3 — CID 58678118
1-[2-[4-chloro-2-(2-isocyanoacetyl)phenoxy]acetyl]-4-[(4-fluorophenyl)methyl]piperidine-4-carbonitrile (PubChem CID 58678118) has the molecular formula C24H21ClFN3O3 and a molecular weight of 453.90 g/mol. Its IUPAC name is 1-[2-[4-chloro-2-(2-isocyanoacetyl)phenoxy]acetyl]-4-[(4-fluorophenyl)methyl]piperidine-4-carbonitrile.
| Compound Name | 1-[2-[4-chloro-2-(2-isocyanoacetyl)phenoxy]acetyl]-4-[(4-fluorophenyl)methyl]piperidine-4-carbonitrile |
|---|---|
| PubChem CID | 58678118 |
| Molecular Formula | C24H21ClFN3O3 |
| Molecular Weight | 453.90 g/mol |
| Exact Mass | 453.13 |
| IUPAC Name | 1-[2-[4-chloro-2-(2-isocyanoacetyl)phenoxy]acetyl]-4-[(4-fluorophenyl)methyl]piperidine-4-carbonitrile |
| SMILES | [C-]#[N+]CC(=O)c1cc(Cl)ccc1OCC(=O)N1CCC(C#N)(Cc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C24H21ClFN3O3/c1-28-14-21(30)20-12-18(25)4-7-22(20)32-15-23(31)29-10-8-24(16-27,9-11-29)13-17-2-5-19(26)6-3-17/h2-7,12H,8-11,13-15H2 |
| InChIKey | AHSRFKXPSDKWEX-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.90 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|