C24H33N3O3SSi — CID 58678941
(3R,4R,6S)-4-azido-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-methyl-6-methylsulfanyloxan-3-ol (PubChem CID 58678941) has the molecular formula C24H33N3O3SSi and a molecular weight of 471.70 g/mol. Its IUPAC name is (3R,4R,6S)-4-azido-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-methyl-6-methylsulfanyloxan-3-ol.
| Compound Name | (3R,4R,6S)-4-azido-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-methyl-6-methylsulfanyloxan-3-ol |
|---|---|
| PubChem CID | 58678941 |
| Molecular Formula | C24H33N3O3SSi |
| Molecular Weight | 471.70 g/mol |
| Exact Mass | 471.20 |
| IUPAC Name | (3R,4R,6S)-4-azido-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-methyl-6-methylsulfanyloxan-3-ol |
| SMILES | CS[C@@H]1OC(CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@H](O)[C@H](N=[N+]=[N-])C1C |
| InChI | InChI=1S/C24H33N3O3SSi/c1-17-21(26-27-25)22(28)20(30-23(17)31-5)16-29-32(24(2,3)4,18-12-8-6-9-13-18)19-14-10-7-11-15-19/h6-15,17,20-23,28H,16H2,1-5H3/t17?,20?,21-,22+,23+/m1/s1 |
| InChIKey | WFVCTCPJYALDFK-WZUMBGCGSA-N |
| XLogP | 4.33 |
| TPSA | 87.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.70 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|