C23H31N3O4SSi — CID 58678948
(3S,4R,6S)-5-azido-4-[tert-butyl(diphenyl)silyl]oxy-2-(hydroxymethyl)-6-methylsulfanyloxan-3-ol (PubChem CID 58678948) has the molecular formula C23H31N3O4SSi and a molecular weight of 473.67 g/mol. Its IUPAC name is (3S,4R,6S)-5-azido-4-[tert-butyl(diphenyl)silyl]oxy-2-(hydroxymethyl)-6-methylsulfanyloxan-3-ol.
| Compound Name | (3S,4R,6S)-5-azido-4-[tert-butyl(diphenyl)silyl]oxy-2-(hydroxymethyl)-6-methylsulfanyloxan-3-ol |
|---|---|
| PubChem CID | 58678948 |
| Molecular Formula | C23H31N3O4SSi |
| Molecular Weight | 473.67 g/mol |
| Exact Mass | 473.18 |
| IUPAC Name | (3S,4R,6S)-5-azido-4-[tert-butyl(diphenyl)silyl]oxy-2-(hydroxymethyl)-6-methylsulfanyloxan-3-ol |
| SMILES | CS[C@@H]1OC(CO)[C@H](O)[C@H](O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)C1N=[N+]=[N-] |
| InChI | InChI=1S/C23H31N3O4SSi/c1-23(2,3)32(16-11-7-5-8-12-16,17-13-9-6-10-14-17)30-21-19(25-26-24)22(31-4)29-18(15-27)20(21)28/h5-14,18-22,27-28H,15H2,1-4H3/t18?,19?,20-,21+,22-/m0/s1 |
| InChIKey | DCGGUGJFXFXFSQ-ZHMMRPBMSA-N |
| XLogP | 3.05 |
| TPSA | 107.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.67 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|