C30H36O5SSi — CID 58678977
(6S,8R,8aS)-8-[tert-butyl(diphenyl)silyl]oxy-6-methylsulfanyl-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-ol (PubChem CID 58678977) has the molecular formula C30H36O5SSi and a molecular weight of 536.77 g/mol. Its IUPAC name is (6S,8R,8aS)-8-[tert-butyl(diphenyl)silyl]oxy-6-methylsulfanyl-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-ol.
| Compound Name | (6S,8R,8aS)-8-[tert-butyl(diphenyl)silyl]oxy-6-methylsulfanyl-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-ol |
|---|---|
| PubChem CID | 58678977 |
| Molecular Formula | C30H36O5SSi |
| Molecular Weight | 536.77 g/mol |
| Exact Mass | 536.21 |
| IUPAC Name | (6S,8R,8aS)-8-[tert-butyl(diphenyl)silyl]oxy-6-methylsulfanyl-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-ol |
| SMILES | CS[C@@H]1OC2COC(c3ccccc3)O[C@@H]2[C@H](O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)C1O |
| InChI | InChI=1S/C30H36O5SSi/c1-30(2,3)37(22-16-10-6-11-17-22,23-18-12-7-13-19-23)35-27-25(31)29(36-4)33-24-20-32-28(34-26(24)27)21-14-8-5-9-15-21/h5-19,24-29,31H,20H2,1-4H3/t24?,25?,26-,27+,28?,29-/m0/s1 |
| InChIKey | VAGXRKALJYSJQM-CVLFNXMLSA-N |
| XLogP | 4.49 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.77 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|