C30H24Cl4O4 — CID 58679036
1-[2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-3,4,5,6-tetrachlorophenyl]ethanone (PubChem CID 58679036) has the molecular formula C30H24Cl4O4 and a molecular weight of 590.33 g/mol. Its IUPAC name is 1-[2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-3,4,5,6-tetrachlorophenyl]ethanone.
| Compound Name | 1-[2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-3,4,5,6-tetrachlorophenyl]ethanone |
|---|---|
| PubChem CID | 58679036 |
| Molecular Formula | C30H24Cl4O4 |
| Molecular Weight | 590.33 g/mol |
| Exact Mass | 588.04 |
| IUPAC Name | 1-[2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-3,4,5,6-tetrachlorophenyl]ethanone |
| SMILES | COc1ccc(C(OCc2c(Cl)c(Cl)c(Cl)c(Cl)c2C(C)=O)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C30H24Cl4O4/c1-18(35)25-24(26(31)28(33)29(34)27(25)32)17-38-30(19-7-5-4-6-8-19,20-9-13-22(36-2)14-10-20)21-11-15-23(37-3)16-12-21/h4-16H,17H2,1-3H3 |
| InChIKey | OEJUPMSDAPHFBF-UHFFFAOYSA-N |
| XLogP | 9.03 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.33 |
| LogP ≤ 5 | 9.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|