C15H18ClFN4O2 — CID 58679446
(1S,3S,4R)-3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-N-[(1S)-1-methoxyethyl]bicyclo[2.2.1]hept-5-ene-2-carboxamide (PubChem CID 58679446) has the molecular formula C15H18ClFN4O2 and a molecular weight of 340.79 g/mol. Its IUPAC name is (1S,3S,4R)-3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-N-[(1S)-1-methoxyethyl]bicyclo[2.2.1]hept-5-ene-2-carboxamide.
| Compound Name | (1S,3S,4R)-3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-N-[(1S)-1-methoxyethyl]bicyclo[2.2.1]hept-5-ene-2-carboxamide |
|---|---|
| PubChem CID | 58679446 |
| Molecular Formula | C15H18ClFN4O2 |
| Molecular Weight | 340.79 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | (1S,3S,4R)-3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-N-[(1S)-1-methoxyethyl]bicyclo[2.2.1]hept-5-ene-2-carboxamide |
| SMILES | CO[C@@H](C)NC(=O)C1[C@@H]2C=C[C@@H](C2)[C@@H]1Nc1nc(Cl)ncc1F |
| InChI | InChI=1S/C15H18ClFN4O2/c1-7(23-2)19-14(22)11-8-3-4-9(5-8)12(11)20-13-10(17)6-18-15(16)21-13/h3-4,6-9,11-12H,5H2,1-2H3,(H,19,22)(H,18,20,21)/t7-,8+,9-,11?,12-/m0/s1 |
| InChIKey | MTEIYQMOWGRDMT-YQQWILQMSA-N |
| XLogP | 1.98 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.79 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|