About (2S,5R)-3-azatricyclo[4.2.1.02,5]non-7-en-4-one
(2S,5R)-3-azatricyclo[4.2.1.02,5]non-7-en-4-one (PubChem CID 58679452) has the molecular formula C8H9NO
and a molecular weight of 135.17 g/mol. Its IUPAC name is (2S,5R)-3-azatricyclo[4.2.1.02,5]non-7-en-4-one.
Molecular Properties
| Compound Name | (2S,5R)-3-azatricyclo[4.2.1.02,5]non-7-en-4-one |
| PubChem CID | 58679452 |
| Molecular Formula | C8H9NO |
| Molecular Weight | 135.17 g/mol |
| Exact Mass | 135.07 |
| IUPAC Name | (2S,5R)-3-azatricyclo[4.2.1.02,5]non-7-en-4-one |
| SMILES | O=C1N[C@H]2C3C=CC(C3)[C@@H]12 |
| InChI | InChI=1S/C8H9NO/c10-8-6-4-1-2-5(3-4)7(6)9-8/h1-2,4-7H,3H2,(H,9,10)/t4?,5?,6-,7+/m1/s1 |
| InChIKey | WBZQHVKGKQXWMW-KBGZMJGOSA-N |
| XLogP | 0.31 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 135.17 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2S,5R)-3-azatricyclo[4.2.1.02,5]non-7-en-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,5R)-3-azatricyclo[4.2.1.02,5]non-7-en-4-one?
The IUPAC name of (2S,5R)-3-azatricyclo[4.2.1.02,5]non-7-en-4-one (CID 58679452) is (2S,5R)-3-azatricyclo[4.2.1.02,5]non-7-en-4-one.
What is the SMILES notation for (2S,5R)-3-azatricyclo[4.2.1.02,5]non-7-en-4-one?
The canonical SMILES for (2S,5R)-3-azatricyclo[4.2.1.02,5]non-7-en-4-one is O=C1N[C@H]2C3C=CC(C3)[C@@H]12.
What is the InChIKey of (2S,5R)-3-azatricyclo[4.2.1.02,5]non-7-en-4-one?
The InChIKey is WBZQHVKGKQXWMW-KBGZMJGOSA-N. The full InChI is InChI=1S/C8H9NO/c10-8-6-4-1-2-5(3-4)7(6)9-8/h1-2,4-7H,3H2,(H,9,10)/t4?,5?,6-,7+/m1/s1.
What are the key properties of (2S,5R)-3-azatricyclo[4.2.1.02,5]non-7-en-4-one?
(2S,5R)-3-azatricyclo[4.2.1.02,5]non-7-en-4-one has a molecular weight of 135.17 g/mol, XLogP of 0.31, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,5R)-3-azatricyclo[4.2.1.02,5]non-7-en-4-one is sourced from PubChem (CID 58679452), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).