C28H34ClF3N4O5S — CID 58679473
2-amino-N-[(2R)-1-[[5-(4-chlorophenyl)-3,3-dimethyl-1,1-dioxo-2H-1,2-thiazol-4-yl]methyl-ethylamino]-1-oxo-3-phenylmethoxypropan-2-yl]-4,4,4-trifluorobutanamide (PubChem CID 58679473) has the molecular formula C28H34ClF3N4O5S and a molecular weight of 631.12 g/mol. Its IUPAC name is 2-amino-N-[(2R)-1-[[5-(4-chlorophenyl)-3,3-dimethyl-1,1-dioxo-2H-1,2-thiazol-4-yl]methyl-ethylamino]-1-oxo-3-phenylmethoxypropan-2-yl]-4,4,4-trifluorobutanamide.
| Compound Name | 2-amino-N-[(2R)-1-[[5-(4-chlorophenyl)-3,3-dimethyl-1,1-dioxo-2H-1,2-thiazol-4-yl]methyl-ethylamino]-1-oxo-3-phenylmethoxypropan-2-yl]-4,4,4-trifluorobutanamide |
|---|---|
| PubChem CID | 58679473 |
| Molecular Formula | C28H34ClF3N4O5S |
| Molecular Weight | 631.12 g/mol |
| Exact Mass | 630.19 |
| IUPAC Name | 2-amino-N-[(2R)-1-[[5-(4-chlorophenyl)-3,3-dimethyl-1,1-dioxo-2H-1,2-thiazol-4-yl]methyl-ethylamino]-1-oxo-3-phenylmethoxypropan-2-yl]-4,4,4-trifluorobutanamide |
| SMILES | CCN(CC1=C(c2ccc(Cl)cc2)S(=O)(=O)NC1(C)C)C(=O)[C@@H](COCc1ccccc1)NC(=O)C(N)CC(F)(F)F |
| InChI | InChI=1S/C28H34ClF3N4O5S/c1-4-36(15-21-24(19-10-12-20(29)13-11-19)42(39,40)35-27(21,2)3)26(38)23(17-41-16-18-8-6-5-7-9-18)34-25(37)22(33)14-28(30,31)32/h5-13,22-23,35H,4,14-17,33H2,1-3H3,(H,34,37)/t22?,23-/m1/s1 |
| InChIKey | QWRVXZSXRMSKLG-OZAIVSQSSA-N |
| XLogP | 3.59 |
| TPSA | 130.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.12 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |