About 5,7-dimethyl-1,3-diazatricyclo[3.3.1.13,7]decan-6-one
5,7-dimethyl-1,3-diazatricyclo[3.3.1.13,7]decan-6-one (PubChem CID 586797) has the molecular formula C10H16N2O
and a molecular weight of 180.25 g/mol. Its IUPAC name is 5,7-dimethyl-1,3-diazatricyclo[3.3.1.13,7]decan-6-one.
Molecular Properties
| Compound Name | 5,7-dimethyl-1,3-diazatricyclo[3.3.1.13,7]decan-6-one |
| PubChem CID | 586797 |
| Molecular Formula | C10H16N2O |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.13 |
| IUPAC Name | 5,7-dimethyl-1,3-diazatricyclo[3.3.1.13,7]decan-6-one |
| SMILES | CC12CN3CN(C1)CC(C)(C3)C2=O |
| InChI | InChI=1S/C10H16N2O/c1-9-3-11-5-10(2,8(9)13)6-12(4-9)7-11/h3-7H2,1-2H3 |
| InChIKey | XGTRHKDYLMRKHW-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5,7-dimethyl-1,3-diazatricyclo[3.3.1.13,7]decan-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,7-dimethyl-1,3-diazatricyclo[3.3.1.13,7]decan-6-one?
The IUPAC name of 5,7-dimethyl-1,3-diazatricyclo[3.3.1.13,7]decan-6-one (CID 586797) is 5,7-dimethyl-1,3-diazatricyclo[3.3.1.13,7]decan-6-one.
What is the SMILES notation for 5,7-dimethyl-1,3-diazatricyclo[3.3.1.13,7]decan-6-one?
The canonical SMILES for 5,7-dimethyl-1,3-diazatricyclo[3.3.1.13,7]decan-6-one is CC12CN3CN(C1)CC(C)(C3)C2=O.
What is the InChIKey of 5,7-dimethyl-1,3-diazatricyclo[3.3.1.13,7]decan-6-one?
The InChIKey is XGTRHKDYLMRKHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N2O/c1-9-3-11-5-10(2,8(9)13)6-12(4-9)7-11/h3-7H2,1-2H3.
What are the key properties of 5,7-dimethyl-1,3-diazatricyclo[3.3.1.13,7]decan-6-one?
5,7-dimethyl-1,3-diazatricyclo[3.3.1.13,7]decan-6-one has a molecular weight of 180.25 g/mol, XLogP of 0.17, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5,7-dimethyl-1,3-diazatricyclo[3.3.1.13,7]decan-6-one is sourced from PubChem (CID 586797), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).