About 3-propoxybenzoic acid
3-propoxybenzoic acid (PubChem CID 586799) has the molecular formula C10H12O3
and a molecular weight of 180.20 g/mol. Its IUPAC name is 3-propoxybenzoic acid.
Molecular Properties
| Compound Name | 3-propoxybenzoic acid |
| PubChem CID | 586799 |
| Molecular Formula | C10H12O3 |
| Molecular Weight | 180.20 g/mol |
| Exact Mass | 180.08 |
| IUPAC Name | 3-propoxybenzoic acid |
| SMILES | CCCOc1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C10H12O3/c1-2-6-13-9-5-3-4-8(7-9)10(11)12/h3-5,7H,2,6H2,1H3,(H,11,12) |
| InChIKey | ZMXUPQVAIFGMPS-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.20 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-propoxybenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-propoxybenzoic acid?
The IUPAC name of 3-propoxybenzoic acid (CID 586799) is 3-propoxybenzoic acid.
What is the SMILES notation for 3-propoxybenzoic acid?
The canonical SMILES for 3-propoxybenzoic acid is CCCOc1cccc(C(=O)O)c1.
What is the InChIKey of 3-propoxybenzoic acid?
The InChIKey is ZMXUPQVAIFGMPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O3/c1-2-6-13-9-5-3-4-8(7-9)10(11)12/h3-5,7H,2,6H2,1H3,(H,11,12).
What are the key properties of 3-propoxybenzoic acid?
3-propoxybenzoic acid has a molecular weight of 180.20 g/mol, XLogP of 2.17, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-propoxybenzoic acid is sourced from PubChem (CID 586799), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).