C22H41NO5 — CID 58679936
tert-butyl N-[(4R,5S)-4-[(E)-11-hydroxyundec-1-enyl]-2,2-dimethyl-1,3-dioxan-5-yl]carbamate (PubChem CID 58679936) has the molecular formula C22H41NO5 and a molecular weight of 399.57 g/mol. Its IUPAC name is tert-butyl N-[(4R,5S)-4-[(E)-11-hydroxyundec-1-enyl]-2,2-dimethyl-1,3-dioxan-5-yl]carbamate.
| Compound Name | tert-butyl N-[(4R,5S)-4-[(E)-11-hydroxyundec-1-enyl]-2,2-dimethyl-1,3-dioxan-5-yl]carbamate |
|---|---|
| PubChem CID | 58679936 |
| Molecular Formula | C22H41NO5 |
| Molecular Weight | 399.57 g/mol |
| Exact Mass | 399.30 |
| IUPAC Name | tert-butyl N-[(4R,5S)-4-[(E)-11-hydroxyundec-1-enyl]-2,2-dimethyl-1,3-dioxan-5-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H]1COC(C)(C)O[C@@H]1/C=C/CCCCCCCCCO |
| InChI | InChI=1S/C22H41NO5/c1-21(2,3)28-20(25)23-18-17-26-22(4,5)27-19(18)15-13-11-9-7-6-8-10-12-14-16-24/h13,15,18-19,24H,6-12,14,16-17H2,1-5H3,(H,23,25)/b15-13+/t18-,19+/m0/s1 |
| InChIKey | MRFJXTRKQCEXDP-ZTIKBKQBSA-N |
| XLogP | 4.70 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.57 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|