C11H9N3O3 — CID 58680017
ethyl (Z)-2-[(E)-1,2-dicyano-2-isocyanoethenyl]-3-hydroxybut-2-enoate (PubChem CID 58680017) has the molecular formula C11H9N3O3 and a molecular weight of 231.21 g/mol. Its IUPAC name is ethyl (Z)-2-[(E)-1,2-dicyano-2-isocyanoethenyl]-3-hydroxybut-2-enoate.
| Compound Name | ethyl (Z)-2-[(E)-1,2-dicyano-2-isocyanoethenyl]-3-hydroxybut-2-enoate |
|---|---|
| PubChem CID | 58680017 |
| Molecular Formula | C11H9N3O3 |
| Molecular Weight | 231.21 g/mol |
| Exact Mass | 231.06 |
| IUPAC Name | ethyl (Z)-2-[(E)-1,2-dicyano-2-isocyanoethenyl]-3-hydroxybut-2-enoate |
| SMILES | [C-]#[N+]/C(C#N)=C(C#N)\C(C(=O)OCC)=C(/C)O |
| InChI | InChI=1S/C11H9N3O3/c1-4-17-11(16)10(7(2)15)8(5-12)9(6-13)14-3/h15H,4H2,1-2H3/b9-8-,10-7- |
| InChIKey | LNDUBFZSBJMNQK-NFIXMJHSSA-N |
| XLogP | 1.60 |
| TPSA | 98.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.21 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|