C27H30N4O — CID 58680162
(E)-3-(3-methylphenyl)-N-[(1S)-1-[3-(4-pyridin-2-ylpiperazin-1-yl)phenyl]ethyl]prop-2-enamide (PubChem CID 58680162) has the molecular formula C27H30N4O and a molecular weight of 426.56 g/mol. Its IUPAC name is (E)-3-(3-methylphenyl)-N-[(1S)-1-[3-(4-pyridin-2-ylpiperazin-1-yl)phenyl]ethyl]prop-2-enamide.
| Compound Name | (E)-3-(3-methylphenyl)-N-[(1S)-1-[3-(4-pyridin-2-ylpiperazin-1-yl)phenyl]ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 58680162 |
| Molecular Formula | C27H30N4O |
| Molecular Weight | 426.56 g/mol |
| Exact Mass | 426.24 |
| IUPAC Name | (E)-3-(3-methylphenyl)-N-[(1S)-1-[3-(4-pyridin-2-ylpiperazin-1-yl)phenyl]ethyl]prop-2-enamide |
| SMILES | Cc1cccc(/C=C/C(=O)N[C@@H](C)c2cccc(N3CCN(c4ccccn4)CC3)c2)c1 |
| InChI | InChI=1S/C27H30N4O/c1-21-7-5-8-23(19-21)12-13-27(32)29-22(2)24-9-6-10-25(20-24)30-15-17-31(18-16-30)26-11-3-4-14-28-26/h3-14,19-20,22H,15-18H2,1-2H3,(H,29,32)/b13-12+/t22-/m0/s1 |
| InChIKey | KKDBARFQQJCJGM-GNNUASRNSA-N |
| XLogP | 4.61 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.56 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|