About 4,4-bis(methanidyloxymethyl)heptane;bis(rutherfordium)
4,4-bis(methanidyloxymethyl)heptane;bis(rutherfordium) (PubChem CID 58680246) has the molecular formula C11H22O2Rf2-2
and a molecular weight of 720.29 g/mol. Its IUPAC name is 4,4-bis(methanidyloxymethyl)heptane;bis(rutherfordium).
Molecular Properties
| Compound Name | 4,4-bis(methanidyloxymethyl)heptane;bis(rutherfordium) |
| PubChem CID | 58680246 |
| Molecular Formula | C11H22O2Rf2-2 |
| Molecular Weight | 720.29 g/mol |
| Exact Mass | 720.41 |
| IUPAC Name | 4,4-bis(methanidyloxymethyl)heptane;bis(rutherfordium) |
| SMILES | [CH2-]OCC(CCC)(CCC)CO[CH2-].[Rf].[Rf] |
| InChI | InChI=1S/C11H22O2.2Rf/c1-5-7-11(8-6-2,9-12-3)10-13-4;;/h3-10H2,1-2H3;;/q-2;; |
| InChIKey | QWASIKOMAJRKOR-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 720.29 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 4,4-bis(methanidyloxymethyl)heptane;bis(rutherfordium) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,4-bis(methanidyloxymethyl)heptane;bis(rutherfordium)?
The IUPAC name of 4,4-bis(methanidyloxymethyl)heptane;bis(rutherfordium) (CID 58680246) is 4,4-bis(methanidyloxymethyl)heptane;bis(rutherfordium).
What is the SMILES notation for 4,4-bis(methanidyloxymethyl)heptane;bis(rutherfordium)?
The canonical SMILES for 4,4-bis(methanidyloxymethyl)heptane;bis(rutherfordium) is [CH2-]OCC(CCC)(CCC)CO[CH2-].[Rf].[Rf].
What is the InChIKey of 4,4-bis(methanidyloxymethyl)heptane;bis(rutherfordium)?
The InChIKey is QWASIKOMAJRKOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22O2.2Rf/c1-5-7-11(8-6-2,9-12-3)10-13-4;;/h3-10H2,1-2H3;;/q-2;;.
What are the key properties of 4,4-bis(methanidyloxymethyl)heptane;bis(rutherfordium)?
4,4-bis(methanidyloxymethyl)heptane;bis(rutherfordium) has a molecular weight of 720.29 g/mol, XLogP of 3.19, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4-bis(methanidyloxymethyl)heptane;bis(rutherfordium) is sourced from PubChem (CID 58680246), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).