C21H35NO5 — CID 58680456
[(3R,4S,5S,6R)-5-methoxy-4-[(2R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] 2-(propan-2-ylamino)acetate (PubChem CID 58680456) has the molecular formula C21H35NO5 and a molecular weight of 381.51 g/mol. Its IUPAC name is [(3R,4S,5S,6R)-5-methoxy-4-[(2R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] 2-(propan-2-ylamino)acetate.
| Compound Name | [(3R,4S,5S,6R)-5-methoxy-4-[(2R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] 2-(propan-2-ylamino)acetate |
|---|---|
| PubChem CID | 58680456 |
| Molecular Formula | C21H35NO5 |
| Molecular Weight | 381.51 g/mol |
| Exact Mass | 381.25 |
| IUPAC Name | [(3R,4S,5S,6R)-5-methoxy-4-[(2R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] 2-(propan-2-ylamino)acetate |
| SMILES | CO[C@@H]1[C@H](OC(=O)CNC(C)C)CC[C@]2(CO2)[C@H]1[C@@]1(C)OC1CC=C(C)C |
| InChI | InChI=1S/C21H35NO5/c1-13(2)7-8-16-20(5,27-16)19-18(24-6)15(9-10-21(19)12-25-21)26-17(23)11-22-14(3)4/h7,14-16,18-19,22H,8-12H2,1-6H3/t15-,16?,18-,19-,20+,21+/m1/s1 |
| InChIKey | BRIQFBBSQGSDKR-GHDUNGJVSA-N |
| XLogP | 2.60 |
| TPSA | 72.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.51 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|