C26H35NO7 — CID 58680470
[(3R,4S,5S,6R)-5-methoxy-4-[(2R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] 2-(4-acetyloxyanilino)acetate (PubChem CID 58680470) has the molecular formula C26H35NO7 and a molecular weight of 473.57 g/mol. Its IUPAC name is [(3R,4S,5S,6R)-5-methoxy-4-[(2R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] 2-(4-acetyloxyanilino)acetate.
| Compound Name | [(3R,4S,5S,6R)-5-methoxy-4-[(2R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] 2-(4-acetyloxyanilino)acetate |
|---|---|
| PubChem CID | 58680470 |
| Molecular Formula | C26H35NO7 |
| Molecular Weight | 473.57 g/mol |
| Exact Mass | 473.24 |
| IUPAC Name | [(3R,4S,5S,6R)-5-methoxy-4-[(2R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] 2-(4-acetyloxyanilino)acetate |
| SMILES | CO[C@@H]1[C@H](OC(=O)CNc2ccc(OC(C)=O)cc2)CC[C@]2(CO2)[C@H]1[C@@]1(C)OC1CC=C(C)C |
| InChI | InChI=1S/C26H35NO7/c1-16(2)6-11-21-25(4,34-21)24-23(30-5)20(12-13-26(24)15-31-26)33-22(29)14-27-18-7-9-19(10-8-18)32-17(3)28/h6-10,20-21,23-24,27H,11-15H2,1-5H3/t20-,21?,23-,24-,25+,26+/m1/s1 |
| InChIKey | WOQMYOQTTHBEOC-UZTZONFYSA-N |
| XLogP | 3.64 |
| TPSA | 98.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.57 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|