C24H41NO5 — CID 58680491
[(3R,4S,5S,6R)-5-methoxy-4-[(2R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] 2-(3,3-dimethylbutan-2-ylamino)acetate (PubChem CID 58680491) has the molecular formula C24H41NO5 and a molecular weight of 423.59 g/mol. Its IUPAC name is [(3R,4S,5S,6R)-5-methoxy-4-[(2R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] 2-(3,3-dimethylbutan-2-ylamino)acetate.
| Compound Name | [(3R,4S,5S,6R)-5-methoxy-4-[(2R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] 2-(3,3-dimethylbutan-2-ylamino)acetate |
|---|---|
| PubChem CID | 58680491 |
| Molecular Formula | C24H41NO5 |
| Molecular Weight | 423.59 g/mol |
| Exact Mass | 423.30 |
| IUPAC Name | [(3R,4S,5S,6R)-5-methoxy-4-[(2R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] 2-(3,3-dimethylbutan-2-ylamino)acetate |
| SMILES | CO[C@@H]1[C@H](OC(=O)CNC(C)C(C)(C)C)CC[C@]2(CO2)[C@H]1[C@@]1(C)OC1CC=C(C)C |
| InChI | InChI=1S/C24H41NO5/c1-15(2)9-10-18-23(7,30-18)21-20(27-8)17(11-12-24(21)14-28-24)29-19(26)13-25-16(3)22(4,5)6/h9,16-18,20-21,25H,10-14H2,1-8H3/t16?,17-,18?,20-,21-,23+,24+/m1/s1 |
| InChIKey | BSDDMVVJYLDGQW-OHITUBDQSA-N |
| XLogP | 3.63 |
| TPSA | 72.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.59 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|