C10H8F2N4O — CID 58681019
(5R)-5-(azidomethyl)-3-(3,5-difluorophenyl)-4,5-dihydro-1,2-oxazole (PubChem CID 58681019) has the molecular formula C10H8F2N4O and a molecular weight of 238.20 g/mol. Its IUPAC name is (5R)-5-(azidomethyl)-3-(3,5-difluorophenyl)-4,5-dihydro-1,2-oxazole.
| Compound Name | (5R)-5-(azidomethyl)-3-(3,5-difluorophenyl)-4,5-dihydro-1,2-oxazole |
|---|---|
| PubChem CID | 58681019 |
| Molecular Formula | C10H8F2N4O |
| Molecular Weight | 238.20 g/mol |
| Exact Mass | 238.07 |
| IUPAC Name | (5R)-5-(azidomethyl)-3-(3,5-difluorophenyl)-4,5-dihydro-1,2-oxazole |
| SMILES | [N-]=[N+]=NC[C@H]1CC(c2cc(F)cc(F)c2)=NO1 |
| InChI | InChI=1S/C10H8F2N4O/c11-7-1-6(2-8(12)3-7)10-4-9(17-15-10)5-14-16-13/h1-3,9H,4-5H2/t9-/m1/s1 |
| InChIKey | HDEGDVLULLYSTJ-SECBINFHSA-N |
| XLogP | 2.77 |
| TPSA | 70.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.20 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|