C19H26O4 — CID 58681361
7-[(1R,2S,3R)-3-hydroxy-2-(4-methylphenyl)-5-oxocyclopentyl]heptanoic acid (PubChem CID 58681361) has the molecular formula C19H26O4 and a molecular weight of 318.41 g/mol. Its IUPAC name is 7-[(1R,2S,3R)-3-hydroxy-2-(4-methylphenyl)-5-oxocyclopentyl]heptanoic acid.
| Compound Name | 7-[(1R,2S,3R)-3-hydroxy-2-(4-methylphenyl)-5-oxocyclopentyl]heptanoic acid |
|---|---|
| PubChem CID | 58681361 |
| Molecular Formula | C19H26O4 |
| Molecular Weight | 318.41 g/mol |
| Exact Mass | 318.18 |
| IUPAC Name | 7-[(1R,2S,3R)-3-hydroxy-2-(4-methylphenyl)-5-oxocyclopentyl]heptanoic acid |
| SMILES | Cc1ccc([C@H]2[C@H](O)CC(=O)[C@@H]2CCCCCCC(=O)O)cc1 |
| InChI | InChI=1S/C19H26O4/c1-13-8-10-14(11-9-13)19-15(16(20)12-17(19)21)6-4-2-3-5-7-18(22)23/h8-11,15,17,19,21H,2-7,12H2,1H3,(H,22,23)/t15-,17+,19+/m0/s1 |
| InChIKey | IGUNXCGYTAJBBB-KVSKMBFKSA-N |
| XLogP | 3.45 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.41 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|