About 5-[[(1S)-5-fluoro-2,3-dihydro-1H-inden-1-yl]methyl]-1H-imidazole
5-[[(1S)-5-fluoro-2,3-dihydro-1H-inden-1-yl]methyl]-1H-imidazole (PubChem CID 58681399) has the molecular formula C13H13FN2
and a molecular weight of 216.26 g/mol. Its IUPAC name is 5-[[(1S)-5-fluoro-2,3-dihydro-1H-inden-1-yl]methyl]-1H-imidazole.
Molecular Properties
| Compound Name | 5-[[(1S)-5-fluoro-2,3-dihydro-1H-inden-1-yl]methyl]-1H-imidazole |
| PubChem CID | 58681399 |
| Molecular Formula | C13H13FN2 |
| Molecular Weight | 216.26 g/mol |
| Exact Mass | 216.11 |
| IUPAC Name | 5-[[(1S)-5-fluoro-2,3-dihydro-1H-inden-1-yl]methyl]-1H-imidazole |
| SMILES | Fc1ccc2c(c1)CC[C@H]2Cc1cnc[nH]1 |
| InChI | InChI=1S/C13H13FN2/c14-11-3-4-13-9(5-11)1-2-10(13)6-12-7-15-8-16-12/h3-5,7-8,10H,1-2,6H2,(H,15,16)/t10-/m0/s1 |
| InChIKey | PQUNDFHTOIRGSF-JTQLQIEISA-N |
| XLogP | 2.82 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.26 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-[[(1S)-5-fluoro-2,3-dihydro-1H-inden-1-yl]methyl]-1H-imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[[(1S)-5-fluoro-2,3-dihydro-1H-inden-1-yl]methyl]-1H-imidazole?
The IUPAC name of 5-[[(1S)-5-fluoro-2,3-dihydro-1H-inden-1-yl]methyl]-1H-imidazole (CID 58681399) is 5-[[(1S)-5-fluoro-2,3-dihydro-1H-inden-1-yl]methyl]-1H-imidazole.
What is the SMILES notation for 5-[[(1S)-5-fluoro-2,3-dihydro-1H-inden-1-yl]methyl]-1H-imidazole?
The canonical SMILES for 5-[[(1S)-5-fluoro-2,3-dihydro-1H-inden-1-yl]methyl]-1H-imidazole is Fc1ccc2c(c1)CC[C@H]2Cc1cnc[nH]1.
What is the InChIKey of 5-[[(1S)-5-fluoro-2,3-dihydro-1H-inden-1-yl]methyl]-1H-imidazole?
The InChIKey is PQUNDFHTOIRGSF-JTQLQIEISA-N. The full InChI is InChI=1S/C13H13FN2/c14-11-3-4-13-9(5-11)1-2-10(13)6-12-7-15-8-16-12/h3-5,7-8,10H,1-2,6H2,(H,15,16)/t10-/m0/s1.
What are the key properties of 5-[[(1S)-5-fluoro-2,3-dihydro-1H-inden-1-yl]methyl]-1H-imidazole?
5-[[(1S)-5-fluoro-2,3-dihydro-1H-inden-1-yl]methyl]-1H-imidazole has a molecular weight of 216.26 g/mol, XLogP of 2.82, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[[(1S)-5-fluoro-2,3-dihydro-1H-inden-1-yl]methyl]-1H-imidazole is sourced from PubChem (CID 58681399), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).