About 1-propan-2-yl-2H-pyridin-1-ium-2-ide;yttrium
1-propan-2-yl-2H-pyridin-1-ium-2-ide;yttrium (PubChem CID 58681573) has the molecular formula C8H11NY
and a molecular weight of 210.09 g/mol. Its IUPAC name is 1-propan-2-yl-2H-pyridin-1-ium-2-ide;yttrium.
Molecular Properties
| Compound Name | 1-propan-2-yl-2H-pyridin-1-ium-2-ide;yttrium |
| PubChem CID | 58681573 |
| Molecular Formula | C8H11NY |
| Molecular Weight | 210.09 g/mol |
| Exact Mass | 209.99 |
| IUPAC Name | 1-propan-2-yl-2H-pyridin-1-ium-2-ide;yttrium |
| SMILES | CC(C)[n+]1[c-]cccc1.[Y] |
| InChI | InChI=1S/C8H11N.Y/c1-8(2)9-6-4-3-5-7-9;/h3-6,8H,1-2H3; |
| InChIKey | UXSNEZLEMVDXNK-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.09 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1-propan-2-yl-2H-pyridin-1-ium-2-ide;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-propan-2-yl-2H-pyridin-1-ium-2-ide;yttrium?
The IUPAC name of 1-propan-2-yl-2H-pyridin-1-ium-2-ide;yttrium (CID 58681573) is 1-propan-2-yl-2H-pyridin-1-ium-2-ide;yttrium.
What is the SMILES notation for 1-propan-2-yl-2H-pyridin-1-ium-2-ide;yttrium?
The canonical SMILES for 1-propan-2-yl-2H-pyridin-1-ium-2-ide;yttrium is CC(C)[n+]1[c-]cccc1.[Y].
What is the InChIKey of 1-propan-2-yl-2H-pyridin-1-ium-2-ide;yttrium?
The InChIKey is UXSNEZLEMVDXNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N.Y/c1-8(2)9-6-4-3-5-7-9;/h3-6,8H,1-2H3;.
What are the key properties of 1-propan-2-yl-2H-pyridin-1-ium-2-ide;yttrium?
1-propan-2-yl-2H-pyridin-1-ium-2-ide;yttrium has a molecular weight of 210.09 g/mol, XLogP of 1.35, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-propan-2-yl-2H-pyridin-1-ium-2-ide;yttrium is sourced from PubChem (CID 58681573), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).