About (Z)-18,18-dimethylnonadec-9-ene
(Z)-18,18-dimethylnonadec-9-ene (PubChem CID 58681653) has the molecular formula C21H42
and a molecular weight of 294.57 g/mol. Its IUPAC name is (Z)-18,18-dimethylnonadec-9-ene.
Molecular Properties
| Compound Name | (Z)-18,18-dimethylnonadec-9-ene |
| PubChem CID | 58681653 |
| Molecular Formula | C21H42 |
| Molecular Weight | 294.57 g/mol |
| Exact Mass | 294.33 |
| IUPAC Name | (Z)-18,18-dimethylnonadec-9-ene |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(C)(C)C |
| InChI | InChI=1S/C21H42/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21(2,3)4/h12-13H,5-11,14-20H2,1-4H3/b13-12- |
| InChIKey | VODGFPUEBZJKKW-SEYXRHQNSA-N |
| XLogP | 8.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 14 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 294.57 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (Z)-18,18-dimethylnonadec-9-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-18,18-dimethylnonadec-9-ene?
The IUPAC name of (Z)-18,18-dimethylnonadec-9-ene (CID 58681653) is (Z)-18,18-dimethylnonadec-9-ene.
What is the SMILES notation for (Z)-18,18-dimethylnonadec-9-ene?
The canonical SMILES for (Z)-18,18-dimethylnonadec-9-ene is CCCCCCCC/C=C\CCCCCCCC(C)(C)C.
What is the InChIKey of (Z)-18,18-dimethylnonadec-9-ene?
The InChIKey is VODGFPUEBZJKKW-SEYXRHQNSA-N. The full InChI is InChI=1S/C21H42/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21(2,3)4/h12-13H,5-11,14-20H2,1-4H3/b13-12-.
What are the key properties of (Z)-18,18-dimethylnonadec-9-ene?
(Z)-18,18-dimethylnonadec-9-ene has a molecular weight of 294.57 g/mol, XLogP of 8.07, 14 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-18,18-dimethylnonadec-9-ene is sourced from PubChem (CID 58681653), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).